Systematic / IUPAC Name: 8-Quinolinyl 1-(5-fluoropentyl)-1H-indazole-3-carboxylate
ID: Reference5125
Other Names:
1-(5-Fluoropentyl)-8-quinolinyl ester-1H-indazole-3-carboxylic acid;
1H-Indazole-3-carboxylic acid, 1-(5-fluoropentyl)-, 8-quinolinyl ester
Formula: C22H20FN3O2
Class: Drugs of Abuse/Illegal Drugs
5-Fluoro NPB-22 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/2/2016 12:59:45 PM |
| InChI | InChI=1S/C22H20FN3O2/c23-13-4-1-5-15-26-18-11-3-2-10-17(18)21(25-26)22(27)28-19-12-6-8-16-9-7-14-24-20(16)19/h2-3,6-12,14H,1,4-5,13,15H2 |
| InChI Key | DZNDVBLSHUYZLI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=NN2CCCCCF)C(=O)OC3=CC=CC4=C3N=CC=C4 |
| CAS | 1445579792 |
| Splash | |
| Other Names |
1-(5-Fluoropentyl)-8-quinolinyl ester-1H-indazole-3-carboxylic acid; 1H-Indazole-3-carboxylic acid, 1-(5-fluoropentyl)-, 8-quinolinyl ester |