Systematic / IUPAC Name: 1-(5-Fluoropentyl)-1H-indole
ID: Reference5130
Other Names: 1H-Indole, 1-(5-fluoropentyl)-
Formula: C13H16FN
5-Fluoropentylindole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/12/2016 8:15:08 AM |
| InChI | InChI=1S/C13H16FN/c14-9-4-1-5-10-15-11-8-12-6-2-3-7-13(12)15/h2-3,6-8,11H,1,4-5,9-10H2 |
| InChI Key | CRRVPRNYXWCQPP-UHFFFAOYSA-N |
| Canonical SMILES | FCCCCCN1C=CC2=CC=CC=C21 |
| CAS | |
| Splash | |
| Other Names | 1H-Indole, 1-(5-fluoropentyl)- |
| ChemSpider | 30646780 |