Systematic / IUPAC Name: 1-(4-Fluoropentyl)-1H-indole
ID: Reference5132
Other Names: 1H-Indole, 1-(4-fluoropentyl)-
Formula: C13H16FN
4-Fluoropentylindole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/12/2016 8:49:57 AM |
| InChI | InChI=1S/C13H16FN/c1-11(14)5-4-9-15-10-8-12-6-2-3-7-13(12)15/h2-3,6-8,10-11H,4-5,9H2,1H3 |
| InChI Key | KBLOSQQBEUFJES-UHFFFAOYSA-N |
| Canonical SMILES | CC(F)CCCN1C=CC2=CC=CC=C21 |
| CAS | 1451385651 |
| Splash | |
| Other Names | 1H-Indole, 1-(4-fluoropentyl)- |
| ChemSpider | 30646779 |