Systematic / IUPAC Name: 1-(2-Fluoropentyl)-1H-indole
ID: Reference5134
Other Names: 1H-Indole, 1-(2-fluoropentyl)-
Formula: C13H16FN
2-Fluoropentylindole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/12/2016 9:20:28 AM |
| InChI | InChI=1S/C13H16FN/c1-2-5-12(14)10-15-9-8-11-6-3-4-7-13(11)15/h3-4,6-9,12H,2,5,10H2,1H3 |
| InChI Key | SPWGOILFUYHPLW-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(F)CN1C=CC2=CC=CC=C21 |
| CAS | |
| Splash | |
| Other Names | 1H-Indole, 1-(2-fluoropentyl)- |
| ChemSpider | 30922488 |