Systematic / IUPAC Name: 3-(1,3-Benzodioxol-5-yl)-N,2-dimethylpropan-1-amine
ID: Reference5135
Other Names:
3,4-Methylenedioxymethamphetamine methyl homolog ;
N,β-Dimethyl-1,3-benzodioxole-5-propanamine
Formula: C12H17NO2
Class: Drugs of Abuse/Illegal Drugs
MDMA Methylene homolog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/12/2016 11:14:31 AM |
| InChI | InChI=1S/C12H17NO2/c1-9(7-13-2)5-10-3-4-11-12(6-10)15-8-14-11/h3-4,6,9,13H,5,7-8H2,1-2H3 |
| InChI Key | OUDAACSONIJLOT-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC2=C(C=C1)OCO2)CNC |
| CAS | |
| Splash | |
| Other Names |
3,4-Methylenedioxymethamphetamine methyl homolog ; N,β-Dimethyl-1,3-benzodioxole-5-propanamine |
| PubChem | 82672270 |