Systematic / IUPAC Name: 2-(4-Chloro-2,5-dimethoxyphenyl)-N-(3,4,5-trimethoxybenzyl)ethanamine
ID: Reference5144
Other Names: Benzeneethanamine, 4-chloro-2,5-dimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]-
Formula: C20H26ClNO5
Class: Drugs of Abuse/Illegal Drugs
30C-NBOMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/13/2016 8:24:03 AM |
| InChI | InChI=1S/C20H26ClNO5/c1-23-16-11-15(21)17(24-2)10-14(16)6-7-22-12-13-8-18(25-3)20(27-5)19(9-13)26-4/h8-11,22H,6-7,12H2,1-5H3 |
| InChI Key | ZQYYVTABADQBTJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)CNCCC2=CC(=C(C=C2OC)Cl)OC |
| CAS | |
| Splash | |
| Other Names | Benzeneethanamine, 4-chloro-2,5-dimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]- |