Systematic / IUPAC Name: 2-(Ethylamino)-1-phenyl-1-pentanone
ID: Reference5149
Other Names: 1-Pentanone, 2-(ethylamino)-1-phenyl-
Formula: C13H19NO
Class: Drugs of Abuse/Illegal Drugs
α-Ethylaminopentiophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/13/2016 12:50:48 PM |
| InChI | InChI=1S/C13H19NO/c1-3-8-12(14-4-2)13(15)11-9-6-5-7-10-11/h5-7,9-10,12,14H,3-4,8H2,1-2H3 |
| InChI Key | QQAHEGDXEXIQPR-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C(=O)C1=CC=CC=C1)NCC |
| CAS | |
| Splash | |
| Other Names | 1-Pentanone, 2-(ethylamino)-1-phenyl- |