Systematic / IUPAC Name: N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanamine
ID: Reference5161
Other Names:
N-[2-(1H-Indol-3-yl)ethyl]-N-propylpropan-1-amine;
1H-Indole-3-ethanamine, N,N-dipropyl-;
3-(2-Dipropylaminoethyl) indole;
3-[2-(Dipropylamino)ethyl]indole ;
Dipropyltryptamine
; more
Formula: C16H24N2
Class: Drugs of Abuse/Illegal Drugs
DPT mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/14/2016 11:42:52 AM |
| InChI | InChI=1S/C16H24N2/c1-3-10-18(11-4-2)12-9-14-13-17-16-8-6-5-7-15(14)16/h5-8,13,17H,3-4,9-12H2,1-2H3 |
| InChI Key | BOOQTIHIKDDPRW-UHFFFAOYSA-N |
| Canonical SMILES | CCCN(CCC)CCC1=CNC2=CC=CC=C21 |
| CAS | |
| Splash | |
| Other Names |
N-[2-(1H-Indol-3-yl)ethyl]-N-propylpropan-1-amine; 1H-Indole-3-ethanamine, N,N-dipropyl-; 3-(2-Dipropylaminoethyl) indole; 3-[2-(Dipropylamino)ethyl]indole ; Dipropyltryptamine; Indole, 3-[2-(dipropylamino)ethyl]- ; N,N-Dipropyltryptamine |
| PubChem | 6091 |
| ChEMBL | CHEMBL1779153 |
| ChemIDPlus | 000061529 |
| ChemSpider | 5866 |
| Wikipedia | Dipropyltryptamine |