Systematic / IUPAC Name: 1-(8-Bromofuro[2,3-f][1]benzofuran-4-yl)-2-propanamine
ID: Reference5162
Other Names: Bromo-benzodifuranyl-isopropylamine
Formula: C13H12BrNO2
Class: Drugs of Abuse/Illegal Drugs
Bromo-dragonFLY mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/14/2016 11:50:00 AM |
| InChI | InChI=1S/C13H12BrNO2/c1-7(15)6-10-8-2-4-17-13(8)11(14)9-3-5-16-12(9)10/h2-5,7H,6,15H2,1H3 |
| InChI Key | GIKPTWKWYXCBEC-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=C2C=COC2=C(C3=C1OC=C3)Br)N |
| CAS | |
| Splash | |
| Other Names | Bromo-benzodifuranyl-isopropylamine |
| PubChem | 9839057 |
| Wikipedia | Bromo-DragonFLY |
| ChEMBL | CHEMBL149024 |
| ChemSpider | 8014776 |