Systematic / IUPAC Name: 1-(Methylamino)-1-phenyl-2-pentanone
ID: Reference5164
Other Names: 2-Pentanone, 1-(methylamino)-1-phenyl-
Formula: C12H17NO
Class: Drugs of Abuse/Illegal Drugs
Isopentedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/14/2016 11:57:49 AM |
| InChI | InChI=1S/C12H17NO/c1-3-7-11(14)12(13-2)10-8-5-4-6-9-10/h4-6,8-9,12-13H,3,7H2,1-2H3 |
| InChI Key | ILGRTMNCRBDXBI-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(=O)C(C1=CC=CC=C1)NC |
| CAS | |
| Splash | |
| Other Names | 2-Pentanone, 1-(methylamino)-1-phenyl- |