Systematic / IUPAC Name: 4-[2-(2-Thienylcarbonyl)hydrazino]benzenesulfonamide
ID: Reference5192
Other Names: 2-Thiophenecarboxylic acid, 2-[4-(aminosulfonyl)phenyl]hydrazide
Formula: C11H11N3O3S2
4-[2-(2-Thienylcarbonyl)hydrazino]benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 249 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/19/2016 7:11:59 AM |
| InChI | InChI=1S/C11H11N3O3S2/c12-19(16,17)9-5-3-8(4-6-9)13-14-11(15)10-2-1-7-18-10/h1-7,13H,(H,14,15)(H2,12,16,17) |
| InChI Key | LGHRLRSRBFTNRZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C(=O)NNC2=CC=C(C=C2)S(=O)(=O)N |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, 2-[4-(aminosulfonyl)phenyl]hydrazide |
| ChemSpider | 2090223 |
| ChEMBL | CHEMBL1523412 |
| PubChem | 2811813 |