Systematic / IUPAC Name: 2-Phenoxy-N-(3-sulfamoylphenyl)nicotinamide
ID: Reference5198
Other Names:
2-Phenoxy-N-(3-sulfamoylphenyl)pyridine-3-carboxamide;
3-Pyridinecarboxamide, N-[3-(aminosulfonyl)phenyl]-2-phenoxy-
Formula: C18H15N3O4S
N-[3-(Aminosulfonyl)phenyl]-2-phenoxynicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/19/2016 2:06:28 PM |
| InChI | InChI=1S/C18H15N3O4S/c19-26(23,24)15-9-4-6-13(12-15)21-17(22)16-10-5-11-20-18(16)25-14-7-2-1-3-8-14/h1-12H,(H,21,22)(H2,19,23,24) |
| InChI Key | IBZZWTRAOWFVTM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)C(=O)NC3=CC(=CC=C3)S(=O)(=O)N |
| CAS | |
| Splash | |
| Other Names |
2-Phenoxy-N-(3-sulfamoylphenyl)pyridine-3-carboxamide; 3-Pyridinecarboxamide, N-[3-(aminosulfonyl)phenyl]-2-phenoxy- |
| ChEMBL | CHEMBL1384618 |
| PubChem | 2812916 |
| ChemSpider | 2091320 |