Systematic / IUPAC Name: 2-(Methylamino)butanedioic acid
ID: Reference521
Other Names:
N-Methyl-D-aspartic acid;
Methyl aspartic acid;
D-Aspartic acid, N-methyl-;
(R)-2-(Methylamino)succinic acid;
(2R)-2-(Methylamino)butanedioic acid
Formula: C5H9NO4
N-Methyl-D-aspartic acid (NMDA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 241 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2015 8:32:12 AM |
| InChI | InChI=1S/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChI Key | HOKKHZGPKSLGJE-GSVOUGTGSA-N |
| Canonical SMILES | CNC(CC(=O)O)C(=O)O |
| CAS | 6384925 |
| Splash | |
| Other Names |
N-Methyl-D-aspartic acid; Methyl aspartic acid; D-Aspartic acid, N-methyl-; (R)-2-(Methylamino)succinic acid; (2R)-2-(Methylamino)butanedioic acid; N-Methyl D-aspartate |
| KEGG | C12269 |
| ChemIDPlus | 006384925 |
| ChemSpider | 4223 |
| Wikipedia | NMDA; N-Methyl-D-aspartic acid |
| HMDb | HMDB02393 |
| ChEBI | CHEBI:31882 |
| PubChem | 22880 |
| ChEMBL | CHEMBL291278 |