Systematic / IUPAC Name: N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(2,3-dihydro-1-benzofuran-4-yl)-1,3-thiazole-4-carboxamide
ID: Reference5214
Other Names: 4-Thiazolecarboxamide, N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2,3-dihydro-4-benzofuranyl)-
Formula: C20H16N2O4S
N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(2,3-dihydro-1-benzofuran-4-yl)-1,3-thiazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 210 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2016 7:05:05 AM |
| InChI | InChI=1S/C20H16N2O4S/c23-19(21-12-4-5-17-18(10-12)26-9-8-25-17)15-11-27-20(22-15)14-2-1-3-16-13(14)6-7-24-16/h1-5,10-11H,6-9H2,(H,21,23) |
| InChI Key | FECJOFZLWHGNFF-UHFFFAOYSA-N |
| Canonical SMILES | C1COC2=CC=CC(=C21)C3=NC(=CS3)C(=O)NC4=CC5=C(C=C4)OCCO5 |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxamide, N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2,3-dihydro-4-benzofuranyl)- |