Systematic / IUPAC Name: N'-(2H-1,4-Benzothiazin-3-yl)-4-fluorobenzohydrazide
ID: Reference5222
Other Names: Benzoic acid, 4-fluoro-, 2-(2H-1,4-benzothiazin-3-yl)hydrazide
Formula: C15H12FN3OS
N'-(2H-1,4-Benzothiazin-3-yl)-4-fluorobenzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2016 11:34:21 AM |
| InChI | InChI=1S/C15H12FN3OS/c16-11-7-5-10(6-8-11)15(20)19-18-14-9-21-13-4-2-1-3-12(13)17-14/h1-8H,9H2,(H,17,18)(H,19,20) |
| InChI Key | BOYCKPIBHFDBFH-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=NC2=CC=CC=C2S1)NNC(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 4-fluoro-, 2-(2H-1,4-benzothiazin-3-yl)hydrazide |
| PubChem | 2816765 |
| ChEMBL | CHEMBL1534655 |
| ChemSpider | 2095095 |