Systematic / IUPAC Name: 2-[2-(3,4-Dimethoxyphenyl)ethyl]-5-nitro-1H-benzo[de]isoquinoline-1,3(2H)-dione
ID: Reference5228
Other Names: 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitro-
Formula: C22H18N2O6
2-(3,4-Dimethoxyphenethyl)-5-nitro-1H-benzo[de]isoquinoline-1,3(2H)-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 7:49:20 AM |
| InChI | InChI=1S/C22H18N2O6/c1-29-18-7-6-13(10-19(18)30-2)8-9-23-21(25)16-5-3-4-14-11-15(24(27)28)12-17(20(14)16)22(23)26/h3-7,10-12H,8-9H2,1-2H3 |
| InChI Key | MZQNYMILMCVOEQ-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitro- |