Systematic / IUPAC Name: N-[4-(3-Chlorophenyl)-2,5-dioxo-1-piperazinyl]-2-{[4-methyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
ID: Reference5231
Other Names: Acetamide, N-[4-(3-chlorophenyl)-2,5-dioxo-1-piperazinyl]-2-{[4-methyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}-
Formula: C20H18ClN7O3S
N-[4-(3-Chlorophenyl)-2,5-dioxopiperazino]-2-{[4-methyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 248 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 5:54:43 AM |
| InChI | InChI=1S/C20H18ClN7O3S/c1-26-19(13-5-7-22-8-6-13)23-24-20(26)32-12-16(29)25-28-11-17(30)27(10-18(28)31)15-4-2-3-14(21)9-15/h2-9H,10-12H2,1H3,(H,25,29) |
| InChI Key | VWHLZXASEGXMLM-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SCC(=O)NN2CC(=O)N(CC2=O)C3=CC(=CC=C3)Cl)C4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-[4-(3-chlorophenyl)-2,5-dioxo-1-piperazinyl]-2-{[4-methyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}- |