Systematic / IUPAC Name: 4-[(E)-{[(2,5-Dichlorophenyl)carbamothioyl]hydrazono}methyl]-2-methoxyphenyl 4-methylbenzenesulfonate
ID: Reference5235
Other Names: Hydrazinecarbothioamide, N-(2,5-dichlorophenyl)-2-[(3-methoxy-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)methylene], (2E)-
Formula: C22H19Cl2N3O4S2
4-{2-[(2,5-Dichloroanilino)carbothioyl]carbohydrazonoyl}-2-methoxyphenyl 4-methylbenzenesulfonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 8:06:30 AM |
| InChI | InChI=1S/C22H19Cl2N3O4S2/c1-14-3-7-17(8-4-14)33(28,29)31-20-10-5-15(11-21(20)30-2)13-25-27-22(32)26-19-12-16(23)6-9-18(19)24/h3-13H,1-2H3,(H2,26,27,32)/b25-13+ |
| InChI Key | PLSMGLCQMYCTSX-DHRITJCHSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)C=NNC(=S)NC3=C(C=CC(=C3)Cl)Cl)OC |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarbothioamide, N-(2,5-dichlorophenyl)-2-[(3-methoxy-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)methylene], (2E)- |