Systematic / IUPAC Name: N-{2-[(4-Chlorobenzyl)sulfanyl]ethyl}-2-furamide
ID: Reference5239
Other Names:
N-{2-[(4-Chlorophenyl)methylsulfanyl]ethyl}furan-2-carboxamide ;
2-Furancarboxamide, N-(2-{[(4-chlorophenyl)methyl]thio}ethyl)-
Formula: C14H14ClNO2S
N-{2-[(4-Chlorobenzyl)thio]ethyl}-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 200 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 9:50:31 AM |
| InChI | InChI=1S/C14H14ClNO2S/c15-12-5-3-11(4-6-12)10-19-9-7-16-14(17)13-2-1-8-18-13/h1-6,8H,7,9-10H2,(H,16,17) |
| InChI Key | ZLSVDRZOHUGDIR-UHFFFAOYSA-N |
| Canonical SMILES | C1=COC(=C1)C(=O)NCCSCC2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names |
N-{2-[(4-Chlorophenyl)methylsulfanyl]ethyl}furan-2-carboxamide ; 2-Furancarboxamide, N-(2-{[(4-chlorophenyl)methyl]thio}ethyl)- |