Systematic / IUPAC Name: Methyl (2E)-2-cyano-3-{1-[4-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl}acrylate
ID: Reference5244
Other Names:
2-Propenoic acid, 2-cyano-3-{1-[4-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl}-, methyl ester, (2E)- ;
Methyl (E)-2-cyano-3-{1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl}prop-2-enoate
Formula: C16H11F3N2O2
Methyl 2-cyano-3-{1-[4-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl}acrylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 12:13:33 PM |
| InChI | InChI=1S/C16H11F3N2O2/c1-23-15(22)11(10-20)9-14-3-2-8-21(14)13-6-4-12(5-7-13)16(17,18)19/h2-9H,1H3/b11-9+ |
| InChI Key | TVKWBRQNNIBIST-PKNBQFBNSA-N |
| Canonical SMILES | COC(=O)C(=CC1=CC=CN1C2=CC=C(C=C2)C(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names |
2-Propenoic acid, 2-cyano-3-{1-[4-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl}-, methyl ester, (2E)- ; Methyl (E)-2-cyano-3-{1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl}prop-2-enoate |