Systematic / IUPAC Name: 2-(Adamantan-1-yl)-N-(3-chlorobenzyl)acetamide
ID: Reference5247
Other Names: Tricyclo[3.3.1.13,7]decane-1-acetamide, N-[(3-chlorophenyl)methyl]-
Formula: C19H24ClNO
N1-(3-Chlorobenzyl)-2-(1-adamantyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 1:02:22 PM |
| InChI | InChI=1S/C19H24ClNO/c20-17-3-1-2-13(7-17)12-21-18(22)11-19-8-14-4-15(9-19)6-16(5-14)10-19/h1-3,7,14-16H,4-6,8-12H2,(H,21,22) |
| InChI Key | JSHISYJBUOHWPQ-UHFFFAOYSA-N |
| Canonical SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)NCC4=CC(=CC=C4)Cl |
| CAS | |
| Splash | |
| Other Names | Tricyclo[3.3.1.13,7]decane-1-acetamide, N-[(3-chlorophenyl)methyl]- |