Systematic / IUPAC Name: 4-[4-(2-Fluorobenzyl)-1-piperazinyl]-1H-indole
ID: Reference5251
Other Names: 1H-Indole, 4-{4-[(2-fluorophenyl)methyl]-1-piperazinyl}-
Formula: C19H20FN3
4-[4-(2-Fluorobenzyl)piperazino]-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 9:42:49 AM |
| InChI | InChI=1S/C19H20FN3/c20-17-5-2-1-4-15(17)14-22-10-12-23(13-11-22)19-7-3-6-18-16(19)8-9-21-18/h1-9,21H,10-14H2 |
| InChI Key | YJSFQVKXLJBVMK-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1CC2=CC=CC=C2F)C3=CC=CC4=C3C=CN4 |
| CAS | |
| Splash | |
| Other Names | 1H-Indole, 4-{4-[(2-fluorophenyl)methyl]-1-piperazinyl}- |