Systematic / IUPAC Name: N-(3,4,5-Trimethoxyphenyl)-1,3,5-triazine-2,4-diamine
ID: Reference5256
Other Names: 1,3,5-Triazine-2,4-diamine, N2-(3,4,5-trimethoxyphenyl)-
Formula: C12H15N5O3
N2-(3,4,5-Trimethoxyphenyl)-1,3,5-triazine-2,4-diamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 9:56:19 AM |
| InChI | InChI=1S/C12H15N5O3/c1-18-8-4-7(5-9(19-2)10(8)20-3)16-12-15-6-14-11(13)17-12/h4-6H,1-3H3,(H3,13,14,15,16,17) |
| InChI Key | XUXJDRHHZUDWRS-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)NC2=NC=NC(=N2)N |
| CAS | |
| Splash | |
| Other Names | 1,3,5-Triazine-2,4-diamine, N2-(3,4,5-trimethoxyphenyl)- |
| ChEMBL | CHEMBL1707251 |
| PubChem | 2730220 |
| ChemSpider | 2012155 |