Systematic / IUPAC Name: 4,5-Diphenyl-1H-pyrazol-3-amine
ID: Reference5257
Other Names: 1H-Pyrazol-3-amine, 4,5-diphenyl-
Formula: C15H13N3
3,4-Diphenyl-1H-pyrazol-5-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 227 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 9:35:13 AM |
| InChI | InChI=1S/C15H13N3/c16-15-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h1-10H,(H3,16,17,18) |
| InChI Key | JWPUMLMBTPMEQA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(NN=C2N)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazol-3-amine, 4,5-diphenyl- |
| ChemSpider | 644202 |
| ChEMBL | CHEMBL1531879 |
| PubChem | 737137 |