Systematic / IUPAC Name: (2E)-3-(4-Chlorophenyl)-2-{[3-(2-methyl-4-pyrimidinyl)phenyl]hydrazono}-3-oxopropanenitrile
ID: Reference5264
Other Names: Benzenepropanenitrile, 4-chloro-α-{2-[3-(2-methyl-4-pyrimidinyl)phenyl]hydrazinylidene}-β-oxo-, (αE)-
Formula: C20H14ClN5O
3-(4-Chlorophenyl)-2-{2-[3-(2-methylpyrimidin-4-yl)phenyl]hydrazono}-3-oxopropanenitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 1:27:23 PM |
| InChI | InChI=1S/C20H14ClN5O/c1-13-23-10-9-18(24-13)15-3-2-4-17(11-15)25-26-19(12-22)20(27)14-5-7-16(21)8-6-14/h2-11,25H,1H3/b26-19+ |
| InChI Key | IEMUSDOCZXLHBG-LGUFXXKBSA-N |
| Canonical SMILES | CC1=NC=CC(=N1)C2=CC(=CC=C2)NN=C(C#N)C(=O)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Benzenepropanenitrile, 4-chloro-α-{2-[3-(2-methyl-4-pyrimidinyl)phenyl]hydrazinylidene}-β-oxo-, (αE)- |