Systematic / IUPAC Name: 1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]thiourea
ID: Reference5265
Other Names:
N,N-Dimethyl-N'-[3-(trifluoromethyl)phenyl]thiourea ;
Thiourea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]-
Formula: C10H11F3N2S
1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 1:49:43 PM |
| InChI | InChI=1S/C10H11F3N2S/c1-15(2)9(16)14-8-5-3-4-7(6-8)10(11,12)13/h3-6H,1-2H3,(H,14,16) |
| InChI Key | MBWGGLMRWAGXPV-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=S)NC1=CC=CC(=C1)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
N,N-Dimethyl-N'-[3-(trifluoromethyl)phenyl]thiourea ; Thiourea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- |
| ChEMBL | CHEMBL1467933 |
| PubChem | 2731112 |
| ChemSpider | 2013020 |