Systematic / IUPAC Name: {[3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazol-4-yl](methoxy)methylene}malononitrile
ID: Reference5266
Other Names: Propanedinitrile, 2-{[3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl]methoxymethylene}-
Formula: C15H9Cl2N3O2
2-[[3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolyl](methoxy)methylene]malononitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2016 7:24:45 AM |
| InChI | InChI=1S/C15H9Cl2N3O2/c1-8-12(15(21-2)9(6-18)7-19)14(20-22-8)13-10(16)4-3-5-11(13)17/h3-5H,1-2H3 |
| InChI Key | ZCOFIUWALSILHN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=C(C#N)C#N)OC |
| CAS | |
| Splash | |
| Other Names | Propanedinitrile, 2-{[3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl]methoxymethylene}- |