Systematic / IUPAC Name: 3-(2,6-Dichlorophenyl)pentanediamide
ID: Reference5269
Other Names: Pentanediamide, 3-(2,6-dichlorophenyl)-
Formula: C11H12Cl2N2O2
3-(2,6-Dichlorophenyl)pentanediamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2016 7:31:46 AM |
| InChI | InChI=1S/C11H12Cl2N2O2/c12-7-2-1-3-8(13)11(7)6(4-9(14)16)5-10(15)17/h1-3,6H,4-5H2,(H2,14,16)(H2,15,17) |
| InChI Key | YILQWHJOWKNDEQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)C(CC(=O)N)CC(=O)N)Cl |
| CAS | |
| Splash | |
| Other Names | Pentanediamide, 3-(2,6-dichlorophenyl)- |