Systematic / IUPAC Name: 3-(Acetyloxy)-2-aminopropanoic acid
ID: Reference527
Other Names:
(S)-3-Acetoxy-2-aminopropanoic acid;
(2S)-3-Acetoxy-2-azaniumylpropanoate;
O-Acetyl-L-serine;
O-3-Acetyl-L-serine;
Serine, O-acetyl-
; more
Formula: C5H9NO4
Class: Endogenous Metabolites
O-Acetylserine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 229 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2015 10:59:39 AM |
| InChI | InChI=1S/C5H9NO4/c1-3(7)10-2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChI Key | VZXPDPZARILFQX-BYPYZUCNSA-N |
| Canonical SMILES | O=C(OCC(N)C(=O)O)C |
| CAS | 5147002 |
| Splash | |
| Other Names |
(S)-3-Acetoxy-2-aminopropanoic acid; (2S)-3-Acetoxy-2-azaniumylpropanoate; O-Acetyl-L-serine; O-3-Acetyl-L-serine; Serine, O-acetyl-; (2S)-3-Acetoxy-2-ammoniopropanoate; L-Serine, O-acetyl- |
| PubChem | 99478; 6971051 |
| ChemIDPlus | 005147002; 025248968 |
| ChemSpider | 89874 |
| ChEBI | CHEBI:17981; CHEBI:58340 |
| KEGG | C00979 |
| HMDb | HMDB03011 |