Systematic / IUPAC Name: (2E)-3-[4-(Trifluoromethoxy)phenyl]acrylic acid
ID: Reference5272
Other Names:
(E)-3-[4-(Trifluoromethoxy)phenyl]acrylic acid ;
3-(4-Trifluoromethoxyphenyl)acrylic acid;
Trifluoromethoxyphenylacrylicacid
Formula: C10H7F3O3
3-[4-(Trifluoromethoxy)phenyl]acrylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2016 8:06:58 AM |
| InChI | InChI=1S/C10H7F3O3/c11-10(12,13)16-8-4-1-7(2-5-8)3-6-9(14)15/h1-6H,(H,14,15)/b6-3+ |
| InChI Key | RNYVTJANWYBGPW-ZZXKWVIFSA-N |
| Canonical SMILES | C1=CC(=CC=C1C=CC(=O)O)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
(E)-3-[4-(Trifluoromethoxy)phenyl]acrylic acid ; 3-(4-Trifluoromethoxyphenyl)acrylic acid; Trifluoromethoxyphenylacrylicacid |