Systematic / IUPAC Name: N-[(Z)-Adamantan-1-yl(amino)methylene]-3,5-dimethyl-1,2-oxazole-4-carboxamide
ID: Reference5275
Other Names: 4-Isoxazolecarboxamide, N-[(1Z)-aminotricyclo[3.3.1.13,7]dec-1-ylmethylene]-3,5-dimethyl-
Formula: C17H23N3O2
N4-[1-Adamantyl(imino)methyl]-3,5-dimethylisoxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2016 9:05:39 AM |
| InChI | InChI=1S/C17H23N3O2/c1-9-14(10(2)22-20-9)15(21)19-16(18)17-6-11-3-12(7-17)5-13(4-11)8-17/h11-13H,3-8H2,1-2H3,(H2,18,19,21) |
| InChI Key | GVOJYZBPJJDSMY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C)C(=O)N=C(C23CC4CC(C2)CC(C4)C3)N |
| CAS | |
| Splash | |
| Other Names | 4-Isoxazolecarboxamide, N-[(1Z)-aminotricyclo[3.3.1.13,7]dec-1-ylmethylene]-3,5-dimethyl- |