Systematic / IUPAC Name: 3-{2-[Isopropyl(methyl)amino]ethyl}-1H-indol-4-ol
ID: Reference5302
Other Names:
4-HO-MiPT ;
1H-Indol-4-ol, 3-{2-[methyl(1-methylethyl)amino]ethyl}- ;
3-{2-[Isopropyl(methyl)amino]ethyl}-1H-indol-4-ol ;
3-{2-[Methyl(1-methylethyl)amino]ethyl}-1H-indol-4-ol ;
4-Hydroxy-N-isopropyl-N-methyltryptamine
Formula: C14H20N2O
Class: Drugs of Abuse/Illegal Drugs
4-Hydroxy MiPT mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 10:41:42 AM |
| InChI | InChI=1S/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3 |
| InChI Key | RXKGHZCQFXXWFQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N(C)CCC1=CNC2=C1C(=CC=C2)O |
| CAS | 77872436 |
| Splash | |
| Other Names |
4-HO-MiPT ; 1H-Indol-4-ol, 3-{2-[methyl(1-methylethyl)amino]ethyl}- ; 3-{2-[Isopropyl(methyl)amino]ethyl}-1H-indol-4-ol ; 3-{2-[Methyl(1-methylethyl)amino]ethyl}-1H-indol-4-ol ; 4-Hydroxy-N-isopropyl-N-methyltryptamine; 4-Hydroxy-N-methyl-N-isopropyltryptamine |
| ChEMBL | CHEMBL171419 |
| ChemSpider | 8258221 |
| PubChem | 10082683 |
| Wikipedia | 4-HO-MiPT |