Systematic / IUPAC Name: 2-Naphthyl 1-(2-fluorophenyl)-1H-indazole-3-carboxylate
ID: Reference5307
Other Names:
1H-Indazole-3-carboxylic acid, 1-(2-fluorophenyl)-, 2-naphthalenyl ester;
Naphthalen-2-yl 1-(2-fluorophenyl)-1H-indazole-3-carboxylate
Formula: C24H15FN2O2
Class: Drugs of Abuse/Illegal Drugs
3-CAF mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 1:06:43 PM |
| InChI | InChI=1S/C24H15FN2O2/c25-20-10-4-6-12-22(20)27-21-11-5-3-9-19(21)23(26-27)24(28)29-18-14-13-16-7-1-2-8-17(16)15-18/h1-15H |
| InChI Key | VBZWFDNXUJTAGG-UHFFFAOYSA-N |
| Canonical SMILES | O=C(OC1=CC(C=CC=C2)=C2C=C1)C3=NN(C4=CC=CC=C4F)C5=C3C=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
1H-Indazole-3-carboxylic acid, 1-(2-fluorophenyl)-, 2-naphthalenyl ester; Naphthalen-2-yl 1-(2-fluorophenyl)-1H-indazole-3-carboxylate |
| ChemSpider | 32055555 |