Systematic / IUPAC Name: 1-(1,3-Benzodioxol-5-yl)-2-(ethylamino)-1-pentanone
ID: Reference5308
Other Names:
1-Pentanone, 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)-;
Ephylone
Formula: C14H19NO3
Class: Drugs of Abuse/Illegal Drugs
N-Ethylpentylone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 1:12:14 PM |
| InChI | InChI=1S/C14H19NO3/c1-3-5-11(15-4-2)14(16)10-6-7-12-13(8-10)18-9-17-12/h6-8,11,15H,3-5,9H2,1-2H3 |
| InChI Key | VERDHJIMZYXGIW-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
1-Pentanone, 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)-; Ephylone |