Systematic / IUPAC Name: [1-(3-Chloropentyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)methanone
ID: Reference5324
Other Names: Methanone, [1-(3-chloropentyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)-
Formula: C21H28ClNO
Class: Drugs of Abuse/Illegal Drugs
UR-144 N-(3-Chloropentyl) analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2016 10:00:21 AM |
| InChI | InChI=1S/C21H28ClNO/c1-6-14(22)11-12-23-13-16(15-9-7-8-10-17(15)23)18(24)19-20(2,3)21(19,4)5/h7-10,13-14,19H,6,11-12H2,1-5H3 |
| InChI Key | MDLQCKHWJOOCCG-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1C(C)(C)C1(C)C)C2=CN(CCC(Cl)CC)C3=C2C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Methanone, [1-(3-chloropentyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- |
| ChemSpider | 29341397 |