Systematic / IUPAC Name: (4-Chloro-1-naphthyl)[1-(5-fluoropentyl)-1H-indol-3-yl]methanone
ID: Reference5333
Other Names:
(4-Chloro-1-naphthalenyl)[1-(5-fluoropentyl)-1H-indol-3-yl]-methanone;
Methanone, (4-chloro-1-naphthalenyl)[1-(5-fluoropentyl)-1H-indol-3-yl]-;
JWH 398 N-(5-fluoropentyl) analog
Formula: C24H21ClFNO
Class: Drugs of Abuse/Illegal Drugs
Cl2201 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2016 11:34:35 AM |
| InChI | InChI=1S/C24H21ClFNO/c25-22-13-12-20(17-8-2-3-9-18(17)22)24(28)21-16-27(15-7-1-6-14-26)23-11-5-4-10-19(21)23/h2-5,8-13,16H,1,6-7,14-15H2 |
| InChI Key | MJSLVWWUOKKZTQ-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1=CC=C(Cl)C2=C1C=CC=C2)C3=CN(CCCCCF)C4=C3C=CC=C4 |
| CAS | 1391486126 |
| Splash | |
| Other Names |
(4-Chloro-1-naphthalenyl)[1-(5-fluoropentyl)-1H-indol-3-yl]-methanone; Methanone, (4-chloro-1-naphthalenyl)[1-(5-fluoropentyl)-1H-indol-3-yl]-; JWH 398 N-(5-fluoropentyl) analog |
| ChemSpider | 29763749 |