Systematic / IUPAC Name: 3-(Diethylamino)-2,2-dimethylpropyl 4-aminobenzoate
ID: Reference5341
Other Names:
Larocaine;
(3-Diethylamino-2,2-dimethyl)propyl 4-aminobenzoat;
[3-(Diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate;
1-Propanol, 3-(diethylamino)-2,2-dimethyl, p-aminobenzoate;
3-(Dimethylamino)-2,2-dimethyl-1-propanol p-aminobenzoate
Formula: C16H26N2O2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
Dimethocaine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2016 2:14:06 PM |
| InChI | InChI=1S/C16H26N2O2/c1-5-18(6-2)11-16(3,4)12-20-15(19)13-7-9-14(17)10-8-13/h7-10H,5-6,11-12,17H2,1-4H3 |
| InChI Key | OWQIUQKMMPDHQQ-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)N |
| CAS | 94155 |
| Splash | |
| Other Names |
Larocaine; (3-Diethylamino-2,2-dimethyl)propyl 4-aminobenzoat; [3-(Diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate; 1-Propanol, 3-(diethylamino)-2,2-dimethyl, p-aminobenzoate; 3-(Dimethylamino)-2,2-dimethyl-1-propanol p-aminobenzoate; 4-Aminobenzoesaeure-3-diethylamino-2,2-dimethylproplylester |
| ChemIDPlus | 000094155 |
| ChemSpider | 6909 |
| Wikipedia | Dimethocaine |
| PubChem | 7177 |