Systematic / IUPAC Name: Methyl (2S,4aR,6aR,7R,9S,10bR)-9-acetoxy-2-(3-furyl)-6a,10b-dimethyl-4,10-dioxododecahydro-2H-benzo[f]isochromene-7-carboxylate
ID: Reference5357
Other Names:
(3S,4aR,6S,8R,8aR,10aR)-6-Acetoxy-3-furan-3-yl-4a,8a-dimethyl-1,5-dioxo-dodecahydro-2-oxa-phenanthrene-8-carboxylic acid methyl ester;
Divinorin A
Formula: C23H28O8
Class: Drugs of Abuse/Illegal Drugs Endogenous Metabolites
Salvinorin A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 188 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/29/2016 11:47:07 AM |
| InChI | InChI=1S/C23H28O8/c1-12(24)30-16-9-15(20(26)28-4)22(2)7-5-14-21(27)31-17(13-6-8-29-11-13)10-23(14,3)19(22)18(16)25/h6,8,11,14-17,19H,5,7,9-10H2,1-4H3/t14-,15-,16-,17-,19?,22-,23-/m0/s1 |
| InChI Key | OBSYBRPAKCASQB-LKTZHPIXSA-N |
| Canonical SMILES | CC(=O)OC1CC(C2(CCC3C(=O)OC(CC3(C2C1=O)C)C4=COC=C4)C)C(=O)OC |
| CAS | 83729015 |
| Splash | |
| Other Names |
(3S,4aR,6S,8R,8aR,10aR)-6-Acetoxy-3-furan-3-yl-4a,8a-dimethyl-1,5-dioxo-dodecahydro-2-oxa-phenanthrene-8-carboxylic acid methyl ester; Divinorin A |
| ChEMBL | CHEMBL178960 |
| Wikipedia | Salvinorin A |
| PubChem | 44388804 |
| ChemSpider | 23244722 |