Systematic / IUPAC Name: 3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
ID: Reference536
Other Names:
β-Alanine, N-(2,4-dihydroxy-3,3-dimethyl-1-oxobutyl), (R)-;
D-(+)-N-(2,4-Dihydroxy-3,3-dimethylbutyryl)-β-alanine;
N-(2,4-Dihydroxy-3,3-dimethylbutyryl)-β-alanine;
N-[(2R)-2,4-Dihydroxy-3,3-dimethylbutanoyl]-β-alanine;
β-Alanine, N-[(2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl]-
; more
Formula: C9H17NO5
Class: Endogenous Metabolites Personal Care Products/Cosmetics
Pantothenic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 208 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2015 10:32:06 AM |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/m0/s1 |
| InChI Key | GHOKWGTUZJEAQD-ZETCQYMHSA-N |
| Canonical SMILES | CC(C)(CO)C(C(=O)NCCC(=O)O)O |
| CAS | 79834 |
| Splash | |
| Other Names |
β-Alanine, N-(2,4-dihydroxy-3,3-dimethyl-1-oxobutyl), (R)-; D-(+)-N-(2,4-Dihydroxy-3,3-dimethylbutyryl)-β-alanine; N-(2,4-Dihydroxy-3,3-dimethylbutyryl)-β-alanine; N-[(2R)-2,4-Dihydroxy-3,3-dimethylbutanoyl]-β-alanine; β-Alanine, N-[(2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl]-; Pantothenic acid; Vitamin B5; D-Pantothenic acid; Pantothenoic acid; (+)-Pantothenic acid; Pantothenic acid, D-; D-(+)-Pantothenic acid |
| HMDb | HMDB00210 |
| ChEBI | CHEBI:46905 |
| KEGG | C00864; D01082; D07413 |
| ChemSpider | 6361 |
| ChemIDPlus | 000079834; 003563846; 020938629; 006227527 |
| Wikipedia | Pantothenic acid |
| PubChem | 6613 |
| ChEMBL | CHEMBL1594 |