Systematic / IUPAC Name: 3-[2-(Diethylamino)ethyl]-1H-indol-4-ol
ID: Reference5361
Other Names:
4-HO-DET ;
4-OH DET ;
CZ 74;
Ethocin ;
3-[2-(Diethylamino)ethyl]-1H-indol-4-ol
; more
Formula: C14H20N2O
Class: Drugs of Abuse/Illegal Drugs
4-Hydroxy DET mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/29/2016 12:52:37 PM |
| InChI | InChI=1S/C14H20N2O/c1-3-16(4-2)9-8-11-10-15-12-6-5-7-13(17)14(11)12/h5-7,10,15,17H,3-4,8-9H2,1-2H3 |
| InChI Key | OHHYMKDBKJPILO-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCC1=CNC2=C1C(=CC=C2)O |
| CAS | 22204893 |
| Splash | |
| Other Names |
4-HO-DET ; 4-OH DET ; CZ 74; Ethocin ; 3-[2-(Diethylamino)ethyl]-1H-indol-4-ol ; 3-(2-Diethylamino-ethyl)-1H-indol-4-ol; 3-(2-Diethylaminoethyl)indol-4-ol; 4-Hydroxy diethyltryptamine ; 4-Hydroxy-N,N- diethyltryptamine; 4-Hydroxy-diethyl-tryptamine |
| Wikipedia | 4-HO-DET |
| ChEMBL | CHEMBL143202 |
| PubChem | 9991554 |
| ChemSpider | 8167136 |