Systematic / IUPAC Name: 2-(2,5-Dimethoxy-3,4-dimethylphenyl)ethanamine
ID: Reference5362
Other Names:
Benzeneethanamine, 2,5-dimethoxy-3,4-dimethyl-;
3,4-Dimethyl-2,5-dimethoxyphenethylamine
Formula: C12H19NO2
Class: Drugs of Abuse/Illegal Drugs
2C-G mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 5:34:23 AM |
| InChI | InChI=1S/C12H19NO2/c1-8-9(2)12(15-4)10(5-6-13)7-11(8)14-3/h7H,5-6,13H2,1-4H3 |
| InChI Key | NFOHGLKGLZIHJQ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C(=C1C)OC)CCN)OC |
| CAS | |
| Splash | |
| Other Names |
Benzeneethanamine, 2,5-dimethoxy-3,4-dimethyl-; 3,4-Dimethyl-2,5-dimethoxyphenethylamine |
| Wikipedia | 2C-G |
| PubChem | 22238091 |
| ChemSpider | 21106224 |
| ChEMBL | CHEMBL127202 |