Systematic / IUPAC Name: 2-(2-Methoxyphenyl)-2-(methylamino)cyclohexanone
ID: Reference5369
Other Names: Cyclohexanone, 2-(2-methoxyphenyl)-2-(methylamino)-
Formula: C14H19NO2
Class: Drugs of Abuse/Illegal Drugs
2-Methoxy ketamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 11:55:57 AM |
| InChI | InChI=1S/C14H19NO2/c1-15-14(10-6-5-9-13(14)16)11-7-3-4-8-12(11)17-2/h3-4,7-8,15H,5-6,9-10H2,1-2H3 |
| InChI Key | OYAUVHORXFUVAJ-UHFFFAOYSA-N |
| Canonical SMILES | CNC1(CCCCC1=O)C2=CC=CC=C2OC |
| CAS | |
| Splash | |
| Other Names | Cyclohexanone, 2-(2-methoxyphenyl)-2-(methylamino)- |
| PubChem | 57483650 |
| ChemSpider | 27470964 |
| Wikipedia | 2-MeO-ketamine |