Systematic / IUPAC Name: O,O-Dimethyl O-(4-nitrophenyl) phosphorothioate
ID: Reference538
Other Names:
Methyl parathion;
Parathion methyl;
Nitrox;
Dimethyl p-nitrophenyl thiophosphate;
O,O-Dimethyl O-(p-nitrophenyl) thionophosphate
; more
Formula: C8H10NO5PS
Class: Pesticides/Herbicides
Parathion-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 167 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2015 12:08:26 PM |
| InChI | InChI=1S/C8H10NO5PS/c1-12-15(16,13-2)14-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 |
| InChI Key | RLBIQVVOMOPOHC-UHFFFAOYSA-N |
| Canonical SMILES | COP(=S)(OC)OC1=CC=C(C=C1)[N+](=O)[O-] |
| CAS | 298000 |
| Splash | |
| Other Names |
Methyl parathion; Parathion methyl; Nitrox; Dimethyl p-nitrophenyl thiophosphate; O,O-Dimethyl O-(p-nitrophenyl) thionophosphate; Dimethyl p-nitrophenyl phosphorothionate; Dimethyl 4-nitrophenyl phosphorothionate; O,O-Dimethyl O-p-nitrophenyl thiophosphate; O,O-Dimethyl O-(4-nitrophenyl) thiophosphate; Phenol, p-nitro, O-ester with O,O-dimethylphosphorothioate; Dimethyl p-nitrophenyl thionophosphate; Phosphorothioic acid O,O-dimethyl-O-p-nitrophenyl ester; Phosphorothioic acid O,O-dimethyl O-(4-nitrophenyl) ester; Metaphos; Vofatox; Wofatox; Metacid; Cekumethion; Oleovofotox; Thiophenit; Devithion; Mepaton; Metacide; Paratox; Paratuf; Quinophos; Tekwaisa; Meptox; Yphos; Kilex parathion; Me-Parathion; Folidol; Partron; Penncap; Parton-m; Penncap mls; Folidol-; Wofatox; Fosferno ; Parapest ; Folidol ; Folidol ; Folidol ; Thylpar ; Wofatox; A-Gro; Metaphor; Dalif |
| KEGG | C14228 |
| Wikipedia | Parathion |
| ChemSpider | 3987 |
| ChemIDPlus | 000298000; 039295506; 074195623 |
| PubChem | 4130 |
| ChEMBL | CHEMBL346516 |
| ChEBI | CHEBI:38746 |