Systematic / IUPAC Name: 3-[2-(Dimethylamino)ethyl]-1H-indol-4-yl acetate
ID: Reference5390
Other Names:
O-Acetylpsilocin;
4-AcO-DMT ;
3-(2-(Dimethylamino)ethyl)-1H-indol-4-yl acetate;
4-Acetoxy-N,N-dimethyltryptamine;
4-Acetoxy-N,N-dimethyltryptamine, free base
Formula: C14H18N2O2
Class: Drugs of Abuse/Illegal Drugs
4-Acetoxy DMT mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 7:33:02 AM |
| InChI | InChI=1S/C14H18N2O2/c1-10(17)18-13-6-4-5-12-14(13)11(9-15-12)7-8-16(2)3/h4-6,9,15H,7-8H2,1-3H3 |
| InChI Key | RTLRUOSYLFOFHV-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)OC1=CC=CC2=C1C(=CN2)CCN(C)C |
| CAS | |
| Splash | |
| Other Names |
O-Acetylpsilocin; 4-AcO-DMT ; 3-(2-(Dimethylamino)ethyl)-1H-indol-4-yl acetate; 4-Acetoxy-N,N-dimethyltryptamine; 4-Acetoxy-N,N-dimethyltryptamine, free base |
| ChemSpider | 21106357 |
| PubChem | 15429212 |
| Wikipedia | O-Acetylpsilocin |