Systematic / IUPAC Name: (1-Butyl-6-methoxy-1H-indol-3-yl)(1-naphthyl)methanone
ID: Reference5395
Other Names:
(1-Butyl-6-methoxy-1H-indol-3-yl)(naphthalen-1-yl)methanone;
Methanone, (1-butyl-6-methoxy-1H-indol-3-yl)-1-naphthalenyl-
Formula: C24H23NO2
Class: Drugs of Abuse/Illegal Drugs
JWH 073 6-methoxyindole analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 8:58:00 AM |
| InChI | InChI=1S/C24H23NO2/c1-3-4-14-25-16-22(20-13-12-18(27-2)15-23(20)25)24(26)21-11-7-9-17-8-5-6-10-19(17)21/h5-13,15-16H,3-4,14H2,1-2H3 |
| InChI Key | YFQNBXNHANIAJR-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1=CN(CCCC)C2=C1C=CC(OC)=C2)C3=CC=CC4=C3C=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
(1-Butyl-6-methoxy-1H-indol-3-yl)(naphthalen-1-yl)methanone; Methanone, (1-butyl-6-methoxy-1H-indol-3-yl)-1-naphthalenyl- |
| ChemSpider | 29341458 |