Systematic / IUPAC Name: 1-(4-Fluorophenyl)-2-(methylamino)-1-butanone
ID: Reference5396
Other Names:
1-Butanone, 1-(4-fluorophenyl)-2-(methylamino)-;
4-FBP
Formula: C11H14FNO
Class: Drugs of Abuse/Illegal Drugs
4-Fluoro buphedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 8:43:56 AM |
| InChI | InChI=1S/C11H14FNO/c1-3-10(13-2)11(14)8-4-6-9(12)7-5-8/h4-7,10,13H,3H2,1-2H3 |
| InChI Key | NEZHKHMZNSFKGS-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=C(C=C1)F)NC |
| CAS | |
| Splash | |
| Other Names |
1-Butanone, 1-(4-fluorophenyl)-2-(methylamino)-; 4-FBP |
| PubChem | 82281904 |