Systematic / IUPAC Name: 8-{2-[Acetyl(methyl)amino]ethyl}-3,6-dimethoxy-4-phenanthryl acetate
ID: Reference5405
Other Names:
N-{2-[5-(Acetyloxy)-3,6-dimethoxy-1-phenanthrenyl]ethyl}-N-methyl-acetamide ;
Acetamide, N-{2-[5-(acetyloxy)-3,6-dimethoxy-1-phenanthrenyl]ethyl}-N-methyl-
Formula: C23H25NO5
Class: Drugs of Abuse/Illegal Drugs
ATM4 4-acetoxy analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 1:01:46 PM |
| InChI | InChI=1S/C23H25NO5/c1-14(25)24(3)11-10-17-12-18(27-4)13-20-19(17)8-6-16-7-9-21(28-5)23(22(16)20)29-15(2)26/h6-9,12-13H,10-11H2,1-5H3 |
| InChI Key | IQCNMUAWZXTDNZ-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)N(C)CCC1=C2C=CC3=C(C2=CC(=C1)OC)C(=C(C=C3)OC)OC(=O)C |
| CAS | 91295748 |
| Splash | |
| Other Names |
N-{2-[5-(Acetyloxy)-3,6-dimethoxy-1-phenanthrenyl]ethyl}-N-methyl-acetamide ; Acetamide, N-{2-[5-(acetyloxy)-3,6-dimethoxy-1-phenanthrenyl]ethyl}-N-methyl- |