Systematic / IUPAC Name: (2,2,3,3-Tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]methanone
ID: Reference5428
Other Names: Methanone, (2,2,3,3-tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]-
Formula: C20H24F3NO
Class: Drugs of Abuse/Illegal Drugs
XLR12 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/4/2016 11:41:45 AM |
| InChI | InChI=1S/C20H24F3NO/c1-18(2)17(19(18,3)4)16(25)14-12-24(11-7-10-20(21,22)23)15-9-6-5-8-13(14)15/h5-6,8-9,12,17H,7,10-11H2,1-4H3 |
| InChI Key | PEXYKZYTXIEEOB-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C(C1(C)C)C(=O)C2=CN(C3=CC=CC=C32)CCCC(F)(F)F)C |
| CAS | 895155789 |
| Splash | |
| Other Names | Methanone, (2,2,3,3-tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]- |
| Wikipedia | XLR-12 |
| PubChem | 11559386 |
| ChEMBL | CHEMBL569082 |
| ChemSpider | 9734160 |