Systematic / IUPAC Name: [5-(3-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone
ID: Reference5431
Other Names:
JWH 368;
[5-(3-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ;
Methanone, [5-(3-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-
Formula: C26H24FNO
Class: Drugs of Abuse/Illegal Drugs
JWH-368 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/4/2016 12:44:36 PM |
| InChI | InChI=1S/C26H24FNO/c1-2-3-6-15-28-18-21(17-25(28)20-11-7-12-22(27)16-20)26(29)24-14-8-10-19-9-4-5-13-23(19)24/h4-5,7-14,16-18H,2-3,6,15H2,1H3 |
| InChI Key | OCOICOMCAJNSCA-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C=C1C2=CC(=CC=C2)F)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 914458314 |
| Splash | |
| Other Names |
JWH 368; [5-(3-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ; Methanone, [5-(3-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl- |
| ChemSpider | 23277909 |
| ChEMBL | CHEMBL220304 |
| PubChem | 44418331 |