Systematic / IUPAC Name: 1-(3-Fluoropentyl)-1H-indole
ID: Reference5436
Other Names: 1H-Indole, 1-(3-fluoropentyl)-
Formula: C13H16FN
Class: Drugs of Abuse/Illegal Drugs
3-Fluoropentylindole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/5/2016 7:08:02 AM |
| InChI | InChI=1S/C13H16FN/c1-2-12(14)8-10-15-9-7-11-5-3-4-6-13(11)15/h3-7,9,12H,2,8,10H2,1H3 |
| InChI Key | DJQBLVURAATKGQ-UHFFFAOYSA-N |
| Canonical SMILES | CCC(F)CCN1C=CC2=CC=CC=C21 |
| CAS | |
| Splash | |
| Other Names | 1H-Indole, 1-(3-fluoropentyl)- |
| ChemSpider | 30646778 |